LFU Cache

Design and implement a data structure for a Least Frequently Used (LFU) cache.

Implement the LFUCache class:

  • LFUCache(int capacity) Initializes the object with the capacity of the data structure.
  • int get(int key) Gets the value of the key if the key exists in the cache. Otherwise, returns -1.
  • void put(int key, int value) Update the value of the key if present, or inserts the key if not already present. When the cache reaches its capacity, it should invalidate and remove the least frequently used key before inserting a new item. For this problem, when there is a tie (i.e., two or more keys with the same frequency), the least recently used key would be invalidated.

To determine the least frequently used key, a use counter is maintained for each key in the cache. The key with the smallest use counter is the least frequently used key.

When a key is first inserted into the cache, its use counter is set to 1 (due to the put operation). The use counter for a key in the cache is incremented either a get or put operation is called on it.

The functions get and put must each run in O(1)average time complexity.

Example 1:

Input ["LFUCache", "put", "put", "get", "put", "get", "get", "put", "get", "get", "get"] [[2], [1, 1], [2, 2], [1], [3, 3], [2], [3], [4, 4], [1], [3], [4]] Output “[null, null, null, 1, null, -1, 3, null, -1, 3, 4]

Explanation // cnt(x) = the use counter for key x // cache=[] will show the last used order for tiebreakers (leftmost element is most recent) LFUCache lfu = new LFUCache(2); lfu.put(1, 1); // cache=[1,_], cnt(1)=1 lfu.put(2, 2); // cache=[2,1], cnt(2)=1, cnt(1)=1 lfu.get(1); // return 1 // cache=[1,2], cnt(2)=1, cnt(1)=2 lfu.put(3, 3); // 2 is the LFU key because cnt(2)=1 is the smallest, invalidate 2.   // cache=[3,1], cnt(3)=1, cnt(1)=2 lfu.get(2); // return -1 (not found) lfu.get(3); // return 3 // cache=[3,1], cnt(3)=2, cnt(1)=2 lfu.put(4, 4); // Both 1 and 3 have the same cnt, but 1 is LRU, invalidate 1. // cache=[4,3], cnt(4)=1, cnt(3)=2 lfu.get(1); // return -1 (not found) lfu.get(3); // return 3 // cache=[3,4], cnt(4)=1, cnt(3)=3 lfu.get(4); // return 4 // cache=[4,3], cnt(4)=2, cnt(3)=3`

Constraints:

  • 0 <= capacity <= 104
  • 0 <= key <= 105
  • 0 <= value <= 109
  • At most 2 * 105 calls will be made to get and put.

Implementation (Maintaining 2 Hash Maps)

Intuition

We need to maintain all the keys, values and frequencies. Without invalidation (removing from the data structure when it reaches capacity), they can be maintained by a HashMap<Integer, Pair<Integer, Integer>>, keyed by the original key and valued by the frequency-value pair.

With the invalidation, we need to maintain the current minimum frequency and delete particular keys. Hence, we can group the keys with the same frequency together and maintain another HashMap<Integer, Set>, keyed by the frequency and valued by the set of keys that have the same frequency. This way, if we know the minimum frequency, we can access the potential keys to be deleted.

Also note that in the case of a tie, we’re required to find the least recently used key and invalidate it, hence we need to keep the frequencies ordered in the Set. Instead of using a TreeSet which adds an extra O(log(N))O(log(N))O(log(N)) time complexity, we can maintain the keys using a LinkedList so that it supports finding both an arbitrary key and the least recently used key in constant time. Fortunately, LinkedHashSet can do the job. Once a key is inserted/updated, we put it to the end of the LinkedHashSet so that we can invalidate the first key in the LinkedHashSet corresponding to the minimum frequency.

The original operations can be transformed into operations on the 2 HashMaps, keeping them in sync and maintaining the minimum frequency.

Since C++ lacks LinkedHashSet, we have to use a workaround like maintaining a list of key and value pairs instead of the LinkedHashSet and keeping the iterator with the frequency in another unordered_map to keep this connection. The idea is similar but a little bit complicated. Another workaround would be to implement your own LRU cache with a doubly linked list.

Algorithm

To make things simpler, assume we have 4 member variables:

  1. HashMap<Integer, Pair<Integer, Integer>> cache, keyed by the original key and valued by the frequency-value pair.
  2. HashMap<Integer, LinkedListHashSet<Integer>> frequencies, keyed by frequency and valued by the set of keys that have the same frequency.
  3. int minf, which is the minimum frequency at any given time.
  4. int capacity, which is the capacity given in the input.

It’s also convenient to have a private utility function insert to insert a key-value pair with a given frequency.

void insert(int key, int frequency, int value)
  1. Insert frequency-value pair into cache with the given key.
  2. Get the LinkedHashSet corresponding to the given frequency (default to empty Set) and insert the given key.
int get(int key)
  1. If the given key is not in the cache, return -1, otherwise go to step 2.
  2. Get the frequency and value from the cache.
  3. Get the LinkedHashSet associated with frequency from frequencies and remove the given key from it, since the usage of the current key is increased by this function call.
  4. If minf == frequency and the above LinkedHashSet is empty, that means there are no more elements used minf times, so increase minf by 1.
  5. Call insert(key, frequency + 1, value), since the current key’s usage has increased from this function call.
  6. Return value
void put(int key, int value)
  1. If capacity <= 0, exit.
  2. If the given key exists in cache, update the value in the original frequency-value(don’t call insert here), and then increment the frequency by using get(key). Exit the function.
  3. If cache.size() == capacity, get the first (least recently used) value in the LinkedHashSet corresponding to minf in frequencies, and remove it from cache and the LinkedHashSet.
  4. If we didn’t exit the function in step 2, it means that this element is a new one, so the minimum frequency cannot possibly be greater than one. Set minf to 1.
  5. Call insert(key, 1, value)
 

Optimizations

Optimized Complexity

Related

LRU-Cache